C27H36O3 — CID 138631455
[2-methyl-4-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate (PubChem CID 138631455) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is [2-methyl-4-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-4-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138631455 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | [2-methyl-4-[2-[4-(2-phenylpropan-2-yl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCOC(C)(C)c1ccc(C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H36O3/c1-20(2)24(28)30-25(3,4)18-19-29-27(7,8)23-16-14-22(15-17-23)26(5,6)21-12-10-9-11-13-21/h9-17H,1,18-19H2,2-8H3 |
| InChIKey | DBPQCNVPZNGTNX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|