C32H41ClO8 — CID 160698630
(3-hydroxy-3-methylbutyl) benzoate;[3-methyl-3-(2-methylprop-2-enoyloxy)butyl] benzoate;2-methylprop-2-enoyl chloride (PubChem CID 160698630) has the molecular formula C32H41ClO8 and a molecular weight of 589.13 g/mol. Its IUPAC name is (3-hydroxy-3-methylbutyl) benzoate;[3-methyl-3-(2-methylprop-2-enoyloxy)butyl] benzoate;2-methylprop-2-enoyl chloride.
| Compound Name | (3-hydroxy-3-methylbutyl) benzoate;[3-methyl-3-(2-methylprop-2-enoyloxy)butyl] benzoate;2-methylprop-2-enoyl chloride |
|---|---|
| PubChem CID | 160698630 |
| Molecular Formula | C32H41ClO8 |
| Molecular Weight | 589.13 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | (3-hydroxy-3-methylbutyl) benzoate;[3-methyl-3-(2-methylprop-2-enoyloxy)butyl] benzoate;2-methylprop-2-enoyl chloride |
| SMILES | C=C(C)C(=O)Cl.C=C(C)C(=O)OC(C)(C)CCOC(=O)c1ccccc1.CC(C)(O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O4.C12H16O3.C4H5ClO/c1-12(2)14(17)20-16(3,4)10-11-19-15(18)13-8-6-5-7-9-13;1-12(2,14)8-9-15-11(13)10-6-4-3-5-7-10;1-3(2)4(5)6/h5-9H,1,10-11H2,2-4H3;3-7,14H,8-9H2,1-2H3;1H2,2H3 |
| InChIKey | RQHZAGZYJSWEOM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.13 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|