C17H19F3O4 — CID 59482787
[3-methyl-3-[2-(trifluoromethyl)prop-2-enoyloxy]butyl] 3-methylbenzoate (PubChem CID 59482787) has the molecular formula C17H19F3O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is [3-methyl-3-[2-(trifluoromethyl)prop-2-enoyloxy]butyl] 3-methylbenzoate.
| Compound Name | [3-methyl-3-[2-(trifluoromethyl)prop-2-enoyloxy]butyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 59482787 |
| Molecular Formula | C17H19F3O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [3-methyl-3-[2-(trifluoromethyl)prop-2-enoyloxy]butyl] 3-methylbenzoate |
| SMILES | C=C(C(=O)OC(C)(C)CCOC(=O)c1cccc(C)c1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3O4/c1-11-6-5-7-13(10-11)15(22)23-9-8-16(3,4)24-14(21)12(2)17(18,19)20/h5-7,10H,2,8-9H2,1,3-4H3 |
| InChIKey | JZBJBQGVVDOBGU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|