C14H15F3O7S — CID 159190488
3,3,3-trifluoro-2-[3-(3-methylbenzoyl)oxypropanoyloxy]propane-1-sulfonic acid (PubChem CID 159190488) has the molecular formula C14H15F3O7S and a molecular weight of 384.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[3-(3-methylbenzoyl)oxypropanoyloxy]propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[3-(3-methylbenzoyl)oxypropanoyloxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 159190488 |
| Molecular Formula | C14H15F3O7S |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 3,3,3-trifluoro-2-[3-(3-methylbenzoyl)oxypropanoyloxy]propane-1-sulfonic acid |
| SMILES | Cc1cccc(C(=O)OCCC(=O)OC(CS(=O)(=O)O)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3O7S/c1-9-3-2-4-10(7-9)13(19)23-6-5-12(18)24-11(14(15,16)17)8-25(20,21)22/h2-4,7,11H,5-6,8H2,1H3,(H,20,21,22) |
| InChIKey | VBAYWHMSUUGGEF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|