C12H13F3O6S — CID 159037104
3,3,3-trifluoro-2-(3-methoxy-4-methylbenzoyl)oxypropane-1-sulfonic acid (PubChem CID 159037104) has the molecular formula C12H13F3O6S and a molecular weight of 342.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(3-methoxy-4-methylbenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-(3-methoxy-4-methylbenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159037104 |
| Molecular Formula | C12H13F3O6S |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3,3,3-trifluoro-2-(3-methoxy-4-methylbenzoyl)oxypropane-1-sulfonic acid |
| SMILES | COc1cc(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)ccc1C |
| InChI | InChI=1S/C12H13F3O6S/c1-7-3-4-8(5-9(7)20-2)11(16)21-10(12(13,14)15)6-22(17,18)19/h3-5,10H,6H2,1-2H3,(H,17,18,19) |
| InChIKey | YIAAMJNEBAGIEA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|