2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid

C10H8BrF3O5S — CID 129061693

IUPAC2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid
SMILESO=C(OC(CS(=O)(=O)O)C(F)(F)F)c1ccc(Br)cc1
InChIInChI=1S/C10H8BrF3O5S/c11-7-3-1-6(2-4-7)9(15)19-8(10(12,13)14)5-20(16,17)18/h1-4,8H,5H2,(H,16,17,18)
InChIKeyQNEMNJRWZFUFFT-UHFFFAOYSA-N
MW377.13 g/mol
LogP2.42
Rot. Bonds4

About 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid

2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 129061693) has the molecular formula C10H8BrF3O5S and a molecular weight of 377.13 g/mol. Its IUPAC name is 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid.

Molecular Properties

Compound Name2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid
PubChem CID129061693
Molecular FormulaC10H8BrF3O5S
Molecular Weight377.13 g/mol
Exact Mass375.92
IUPAC Name2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid
SMILESO=C(OC(CS(=O)(=O)O)C(F)(F)F)c1ccc(Br)cc1
InChIInChI=1S/C10H8BrF3O5S/c11-7-3-1-6(2-4-7)9(15)19-8(10(12,13)14)5-20(16,17)18/h1-4,8H,5H2,(H,16,17,18)
InChIKeyQNEMNJRWZFUFFT-UHFFFAOYSA-N
XLogP2.42
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500377.13
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid?
The IUPAC name of 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid (CID 129061693) is 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid.
What is the SMILES notation for 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid?
The canonical SMILES for 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid is O=C(OC(CS(=O)(=O)O)C(F)(F)F)c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid?
The InChIKey is QNEMNJRWZFUFFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3O5S/c11-7-3-1-6(2-4-7)9(15)19-8(10(12,13)14)5-20(16,17)18/h1-4,8H,5H2,(H,16,17,18).
What are the key properties of 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid?
2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid has a molecular weight of 377.13 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid is sourced from PubChem (CID 129061693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).