C10H8BrF3O5S — CID 129061693
2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 129061693) has the molecular formula C10H8BrF3O5S and a molecular weight of 377.13 g/mol. Its IUPAC name is 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061693 |
| Molecular Formula | C10H8BrF3O5S |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | 2-(4-bromobenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H8BrF3O5S/c11-7-3-1-6(2-4-7)9(15)19-8(10(12,13)14)5-20(16,17)18/h1-4,8H,5H2,(H,16,17,18) |
| InChIKey | QNEMNJRWZFUFFT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|