C12H8Br3F3O7S — CID 157183473
3,3,3-trifluoro-2-[3-oxo-3-(2,4,6-tribromophenoxy)propanoyl]oxypropane-1-sulfonic acid (PubChem CID 157183473) has the molecular formula C12H8Br3F3O7S and a molecular weight of 592.96 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[3-oxo-3-(2,4,6-tribromophenoxy)propanoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[3-oxo-3-(2,4,6-tribromophenoxy)propanoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 157183473 |
| Molecular Formula | C12H8Br3F3O7S |
| Molecular Weight | 592.96 g/mol |
| Exact Mass | 589.75 |
| IUPAC Name | 3,3,3-trifluoro-2-[3-oxo-3-(2,4,6-tribromophenoxy)propanoyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(CC(=O)OC(CS(=O)(=O)O)C(F)(F)F)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H8Br3F3O7S/c13-5-1-6(14)11(7(15)2-5)25-10(20)3-9(19)24-8(12(16,17)18)4-26(21,22)23/h1-2,8H,3-4H2,(H,21,22,23) |
| InChIKey | MVHZYHIVPLURIK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|