C8H3Br3Cl2O2 — CID 14365696
(2,4,6-tribromophenyl) 2,2-dichloroacetate (PubChem CID 14365696) has the molecular formula C8H3Br3Cl2O2 and a molecular weight of 441.73 g/mol. Its IUPAC name is (2,4,6-tribromophenyl) 2,2-dichloroacetate.
| Compound Name | (2,4,6-tribromophenyl) 2,2-dichloroacetate |
|---|---|
| PubChem CID | 14365696 |
| Molecular Formula | C8H3Br3Cl2O2 |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 437.71 |
| IUPAC Name | (2,4,6-tribromophenyl) 2,2-dichloroacetate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1Br)C(Cl)Cl |
| InChI | InChI=1S/C8H3Br3Cl2O2/c9-3-1-4(10)6(5(11)2-3)15-8(14)7(12)13/h1-2,7H |
| InChIKey | VLASWKLCPVQLGD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|