C17H9Br3O2 — CID 4586991
(2,4,6-tribromophenyl) naphthalene-1-carboxylate (PubChem CID 4586991) has the molecular formula C17H9Br3O2 and a molecular weight of 484.97 g/mol. Its IUPAC name is (2,4,6-tribromophenyl) naphthalene-1-carboxylate.
| Compound Name | (2,4,6-tribromophenyl) naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 4586991 |
| Molecular Formula | C17H9Br3O2 |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 481.82 |
| IUPAC Name | (2,4,6-tribromophenyl) naphthalene-1-carboxylate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1Br)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H9Br3O2/c18-11-8-14(19)16(15(20)9-11)22-17(21)13-7-3-5-10-4-1-2-6-12(10)13/h1-9H |
| InChIKey | GTCGIALSRAFXSS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|