About naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate
naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate (PubChem CID 174478556) has the molecular formula C33H19FO5
and a molecular weight of 514.51 g/mol. Its IUPAC name is naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate |
| PubChem CID | 174478556 |
| Molecular Formula | C33H19FO5 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate |
| SMILES | O=C(OC(=O)c1c(OC(=O)c2cccc3ccccc23)cc(F)c2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H19FO5/c34-28-19-29(38-31(35)26-17-7-11-20-9-1-3-13-22(20)26)30(25-16-6-5-15-24(25)28)33(37)39-32(36)27-18-8-12-21-10-2-4-14-23(21)27/h1-19H |
| InChIKey | JMBPXOCZDCAWJM-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate?
The IUPAC name of naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate (CID 174478556) is naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate.
What is the SMILES notation for naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate?
The canonical SMILES for naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate is O=C(OC(=O)c1c(OC(=O)c2cccc3ccccc23)cc(F)c2ccccc12)c1cccc2ccccc12.
What is the InChIKey of naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate?
The InChIKey is JMBPXOCZDCAWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H19FO5/c34-28-19-29(38-31(35)26-17-7-11-20-9-1-3-13-22(20)26)30(25-16-6-5-15-24(25)28)33(37)39-32(36)27-18-8-12-21-10-2-4-14-23(21)27/h1-19H.
What are the key properties of naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate?
naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate has a molecular weight of 514.51 g/mol, XLogP of 7.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1-carbonyl 4-fluoro-2-(naphthalene-1-carbonyloxy)naphthalene-1-carboxylate is sourced from PubChem (CID 174478556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).