About naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate
naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate (PubChem CID 174648773) has the molecular formula C22H15NO3
and a molecular weight of 341.37 g/mol. Its IUPAC name is naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate.
Molecular Properties
| Compound Name | naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate |
| PubChem CID | 174648773 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate |
| SMILES | Nc1cccc2c(C(=O)OC(=O)c3cccc4ccccc34)cccc12 |
| InChI | InChI=1S/C22H15NO3/c23-20-13-5-9-16-17(20)10-4-12-19(16)22(25)26-21(24)18-11-3-7-14-6-1-2-8-15(14)18/h1-13H,23H2 |
| InChIKey | UZSQFAKAERFUEP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate?
The IUPAC name of naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate (CID 174648773) is naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate.
What is the SMILES notation for naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate?
The canonical SMILES for naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate is Nc1cccc2c(C(=O)OC(=O)c3cccc4ccccc34)cccc12.
What is the InChIKey of naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate?
The InChIKey is UZSQFAKAERFUEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO3/c23-20-13-5-9-16-17(20)10-4-12-19(16)22(25)26-21(24)18-11-3-7-14-6-1-2-8-15(14)18/h1-13H,23H2.
What are the key properties of naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate?
naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate has a molecular weight of 341.37 g/mol, XLogP of 4.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1-carbonyl 5-aminonaphthalene-1-carboxylate is sourced from PubChem (CID 174648773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).