C36H24O4 — CID 134263043
[(E)-2-(naphthalene-1-carbonyloxy)-1,2-diphenylethenyl] naphthalene-1-carboxylate (PubChem CID 134263043) has the molecular formula C36H24O4 and a molecular weight of 520.58 g/mol. Its IUPAC name is [(E)-2-(naphthalene-1-carbonyloxy)-1,2-diphenylethenyl] naphthalene-1-carboxylate.
| Compound Name | [(E)-2-(naphthalene-1-carbonyloxy)-1,2-diphenylethenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134263043 |
| Molecular Formula | C36H24O4 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [(E)-2-(naphthalene-1-carbonyloxy)-1,2-diphenylethenyl] naphthalene-1-carboxylate |
| SMILES | O=C(O/C(=C(/OC(=O)c1cccc2ccccc12)c1ccccc1)c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C36H24O4/c37-35(31-23-11-19-25-13-7-9-21-29(25)31)39-33(27-15-3-1-4-16-27)34(28-17-5-2-6-18-28)40-36(38)32-24-12-20-26-14-8-10-22-30(26)32/h1-24H/b34-33+ |
| InChIKey | VUJBUJGYZRDSTJ-JEIPZWNWSA-N |
| XLogP | 8.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|