C17H8Cl4O3 — CID 134111711
(2,3,4,5-tetrachloro-6-hydroxyphenyl) naphthalene-1-carboxylate (PubChem CID 134111711) has the molecular formula C17H8Cl4O3 and a molecular weight of 402.06 g/mol. Its IUPAC name is (2,3,4,5-tetrachloro-6-hydroxyphenyl) naphthalene-1-carboxylate.
| Compound Name | (2,3,4,5-tetrachloro-6-hydroxyphenyl) naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134111711 |
| Molecular Formula | C17H8Cl4O3 |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | (2,3,4,5-tetrachloro-6-hydroxyphenyl) naphthalene-1-carboxylate |
| SMILES | O=C(Oc1c(O)c(Cl)c(Cl)c(Cl)c1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H8Cl4O3/c18-11-12(19)14(21)16(15(22)13(11)20)24-17(23)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,22H |
| InChIKey | JOTUGRZNFQBSSQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|