C18H9Br3O4 — CID 162117011
8-(2,4,6-tribromophenoxy)carbonylnaphthalene-1-carboxylic acid (PubChem CID 162117011) has the molecular formula C18H9Br3O4 and a molecular weight of 528.98 g/mol. Its IUPAC name is 8-(2,4,6-tribromophenoxy)carbonylnaphthalene-1-carboxylic acid.
| Compound Name | 8-(2,4,6-tribromophenoxy)carbonylnaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 162117011 |
| Molecular Formula | C18H9Br3O4 |
| Molecular Weight | 528.98 g/mol |
| Exact Mass | 525.81 |
| IUPAC Name | 8-(2,4,6-tribromophenoxy)carbonylnaphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2cccc(C(=O)Oc3c(Br)cc(Br)cc3Br)c12 |
| InChI | InChI=1S/C18H9Br3O4/c19-10-7-13(20)16(14(21)8-10)25-18(24)12-6-2-4-9-3-1-5-11(15(9)12)17(22)23/h1-8H,(H,22,23) |
| InChIKey | WFYDEWWEHKPKCE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.98 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|