C44H18Br8O16 — CID 23252278
2-[3-[3,5-bis[(2,4-dibromo-6-carboxyphenoxy)carbonyl]phenyl]-5-(2,4-dibromo-6-carboxyphenoxy)carbonylbenzoyl]oxy-3,5-dibromobenzoic acid (PubChem CID 23252278) has the molecular formula C44H18Br8O16 and a molecular weight of 1441.84 g/mol. Its IUPAC name is 2-[3-[3,5-bis[(2,4-dibromo-6-carboxyphenoxy)carbonyl]phenyl]-5-(2,4-dibromo-6-carboxyphenoxy)carbonylbenzoyl]oxy-3,5-dibromobenzoic acid.
| Compound Name | 2-[3-[3,5-bis[(2,4-dibromo-6-carboxyphenoxy)carbonyl]phenyl]-5-(2,4-dibromo-6-carboxyphenoxy)carbonylbenzoyl]oxy-3,5-dibromobenzoic acid |
|---|---|
| PubChem CID | 23252278 |
| Molecular Formula | C44H18Br8O16 |
| Molecular Weight | 1441.84 g/mol |
| Exact Mass | 1433.41 |
| IUPAC Name | 2-[3-[3,5-bis[(2,4-dibromo-6-carboxyphenoxy)carbonyl]phenyl]-5-(2,4-dibromo-6-carboxyphenoxy)carbonylbenzoyl]oxy-3,5-dibromobenzoic acid |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1C(=O)O)c1cc(C(=O)Oc2c(Br)cc(Br)cc2C(=O)O)cc(-c2cc(C(=O)Oc3c(Br)cc(Br)cc3C(=O)O)cc(C(=O)Oc3c(Br)cc(Br)cc3C(=O)O)c2)c1 |
| InChI | InChI=1S/C44H18Br8O16/c45-21-7-25(37(53)54)33(29(49)11-21)65-41(61)17-1-15(2-18(5-17)42(62)66-34-26(38(55)56)8-22(46)12-30(34)50)16-3-19(43(63)67-35-27(39(57)58)9-23(47)13-31(35)51)6-20(4-16)44(64)68-36-28(40(59)60)10-24(48)14-32(36)52/h1-14H,(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | FEQVLPFSSISJIR-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 254.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1441.84 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|