C9H3Br2F3O4 — CID 154611991
3,5-dibromo-2-(2,2,2-trifluoroacetyl)oxybenzoic acid (PubChem CID 154611991) has the molecular formula C9H3Br2F3O4 and a molecular weight of 391.92 g/mol. Its IUPAC name is 3,5-dibromo-2-(2,2,2-trifluoroacetyl)oxybenzoic acid.
| Compound Name | 3,5-dibromo-2-(2,2,2-trifluoroacetyl)oxybenzoic acid |
|---|---|
| PubChem CID | 154611991 |
| Molecular Formula | C9H3Br2F3O4 |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 389.84 |
| IUPAC Name | 3,5-dibromo-2-(2,2,2-trifluoroacetyl)oxybenzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(Br)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H3Br2F3O4/c10-3-1-4(7(15)16)6(5(11)2-3)18-8(17)9(12,13)14/h1-2H,(H,15,16) |
| InChIKey | IVUJHGPAYVDWJK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|