C18H10Br4O8 — CID 177194221
3,5-dibromo-2-[(E)-4-[2,4-dibromo-6-(dihydroxymethyl)phenoxy]-4-oxobut-2-enoyl]oxybenzoic acid (PubChem CID 177194221) has the molecular formula C18H10Br4O8 and a molecular weight of 673.89 g/mol. Its IUPAC name is 3,5-dibromo-2-[(E)-4-[2,4-dibromo-6-(dihydroxymethyl)phenoxy]-4-oxobut-2-enoyl]oxybenzoic acid.
| Compound Name | 3,5-dibromo-2-[(E)-4-[2,4-dibromo-6-(dihydroxymethyl)phenoxy]-4-oxobut-2-enoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 177194221 |
| Molecular Formula | C18H10Br4O8 |
| Molecular Weight | 673.89 g/mol |
| Exact Mass | 669.71 |
| IUPAC Name | 3,5-dibromo-2-[(E)-4-[2,4-dibromo-6-(dihydroxymethyl)phenoxy]-4-oxobut-2-enoyl]oxybenzoic acid |
| SMILES | O=C(/C=C/C(=O)Oc1c(Br)cc(Br)cc1C(O)O)Oc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C18H10Br4O8/c19-7-3-9(17(25)26)15(11(21)5-7)29-13(23)1-2-14(24)30-16-10(18(27)28)4-8(20)6-12(16)22/h1-6,17,25-26H,(H,27,28)/b2-1+ |
| InChIKey | ZEZQWHYCWAIJET-OWOJBTEDSA-N |
| XLogP | 4.49 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|