C12H8Br3O7S- — CID 156666356
2-[(Z)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxyethanesulfonate (PubChem CID 156666356) has the molecular formula C12H8Br3O7S- and a molecular weight of 535.97 g/mol. Its IUPAC name is 2-[(Z)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxyethanesulfonate.
| Compound Name | 2-[(Z)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 156666356 |
| Molecular Formula | C12H8Br3O7S- |
| Molecular Weight | 535.97 g/mol |
| Exact Mass | 532.75 |
| IUPAC Name | 2-[(Z)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxyethanesulfonate |
| SMILES | O=C(/C=C\C(=O)Oc1c(Br)cc(Br)cc1Br)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H9Br3O7S/c13-7-5-8(14)12(9(15)6-7)22-11(17)2-1-10(16)21-3-4-23(18,19)20/h1-2,5-6H,3-4H2,(H,18,19,20)/p-1/b2-1- |
| InChIKey | UICPEXBNUYISKT-UPHRSURJSA-M |
| XLogP | 2.52 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.97 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|