C13H5Br5O2 — CID 19911714
(2,4,6-tribromophenyl) 3,5-dibromobenzoate (PubChem CID 19911714) has the molecular formula C13H5Br5O2 and a molecular weight of 592.70 g/mol. Its IUPAC name is (2,4,6-tribromophenyl) 3,5-dibromobenzoate.
| Compound Name | (2,4,6-tribromophenyl) 3,5-dibromobenzoate |
|---|---|
| PubChem CID | 19911714 |
| Molecular Formula | C13H5Br5O2 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 587.62 |
| IUPAC Name | (2,4,6-tribromophenyl) 3,5-dibromobenzoate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1Br)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H5Br5O2/c14-7-1-6(2-8(15)3-7)13(19)20-12-10(17)4-9(16)5-11(12)18/h1-5H |
| InChIKey | IBTSODCCCZUFLY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|