C17H14Br2O4 — CID 177194260
3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid (PubChem CID 177194260) has the molecular formula C17H14Br2O4 and a molecular weight of 442.10 g/mol. Its IUPAC name is 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid.
| Compound Name | 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid |
|---|---|
| PubChem CID | 177194260 |
| Molecular Formula | C17H14Br2O4 |
| Molecular Weight | 442.10 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid |
| SMILES | CCc1cc(C)cc(C(=O)Oc2c(Br)cc(Br)cc2C(=O)O)c1 |
| InChI | InChI=1S/C17H14Br2O4/c1-3-10-4-9(2)5-11(6-10)17(22)23-15-13(16(20)21)7-12(18)8-14(15)19/h4-8H,3H2,1-2H3,(H,20,21) |
| InChIKey | ZXEKFXVGXCMUCI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.10 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|