3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid

C17H14Br2O4 — CID 177194260

IUPAC3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid
SMILESCCc1cc(C)cc(C(=O)Oc2c(Br)cc(Br)cc2C(=O)O)c1
InChIInChI=1S/C17H14Br2O4/c1-3-10-4-9(2)5-11(6-10)17(22)23-15-13(16(20)21)7-12(18)8-14(15)19/h4-8H,3H2,1-2H3,(H,20,21)
InChIKeyZXEKFXVGXCMUCI-UHFFFAOYSA-N
MW442.10 g/mol
LogP5.00
Rot. Bonds4

About 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid

3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid (PubChem CID 177194260) has the molecular formula C17H14Br2O4 and a molecular weight of 442.10 g/mol. Its IUPAC name is 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid.

Molecular Properties

Compound Name3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid
PubChem CID177194260
Molecular FormulaC17H14Br2O4
Molecular Weight442.10 g/mol
Exact Mass439.93
IUPAC Name3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid
SMILESCCc1cc(C)cc(C(=O)Oc2c(Br)cc(Br)cc2C(=O)O)c1
InChIInChI=1S/C17H14Br2O4/c1-3-10-4-9(2)5-11(6-10)17(22)23-15-13(16(20)21)7-12(18)8-14(15)19/h4-8H,3H2,1-2H3,(H,20,21)
InChIKeyZXEKFXVGXCMUCI-UHFFFAOYSA-N
XLogP5.00
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500442.10
LogP ≤ 55.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid?
The IUPAC name of 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid (CID 177194260) is 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid.
What is the SMILES notation for 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid?
The canonical SMILES for 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid is CCc1cc(C)cc(C(=O)Oc2c(Br)cc(Br)cc2C(=O)O)c1.
What is the InChIKey of 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid?
The InChIKey is ZXEKFXVGXCMUCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Br2O4/c1-3-10-4-9(2)5-11(6-10)17(22)23-15-13(16(20)21)7-12(18)8-14(15)19/h4-8H,3H2,1-2H3,(H,20,21).
What are the key properties of 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid?
3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid has a molecular weight of 442.10 g/mol, XLogP of 5.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2-(3-ethyl-5-methylbenzoyl)oxybenzoic acid is sourced from PubChem (CID 177194260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).