C11H9Br2IO4 — CID 154612020
3,5-dibromo-2-(4-iodobutanoyloxy)benzoic acid (PubChem CID 154612020) has the molecular formula C11H9Br2IO4 and a molecular weight of 491.90 g/mol. Its IUPAC name is 3,5-dibromo-2-(4-iodobutanoyloxy)benzoic acid.
| Compound Name | 3,5-dibromo-2-(4-iodobutanoyloxy)benzoic acid |
|---|---|
| PubChem CID | 154612020 |
| Molecular Formula | C11H9Br2IO4 |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 489.79 |
| IUPAC Name | 3,5-dibromo-2-(4-iodobutanoyloxy)benzoic acid |
| SMILES | O=C(CCCI)Oc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H9Br2IO4/c12-6-4-7(11(16)17)10(8(13)5-6)18-9(15)2-1-3-14/h4-5H,1-3H2,(H,16,17) |
| InChIKey | RNGMDMBGXMKECF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|