C15H14Br2O5 — CID 90685745
7-(2,4-dibromo-6-formylphenoxy)-2-methylidene-7-oxoheptanoic acid (PubChem CID 90685745) has the molecular formula C15H14Br2O5 and a molecular weight of 434.08 g/mol. Its IUPAC name is 7-(2,4-dibromo-6-formylphenoxy)-2-methylidene-7-oxoheptanoic acid.
| Compound Name | 7-(2,4-dibromo-6-formylphenoxy)-2-methylidene-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 90685745 |
| Molecular Formula | C15H14Br2O5 |
| Molecular Weight | 434.08 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | 7-(2,4-dibromo-6-formylphenoxy)-2-methylidene-7-oxoheptanoic acid |
| SMILES | C=C(CCCCC(=O)Oc1c(Br)cc(Br)cc1C=O)C(=O)O |
| InChI | InChI=1S/C15H14Br2O5/c1-9(15(20)21)4-2-3-5-13(19)22-14-10(8-18)6-11(16)7-12(14)17/h6-8H,1-5H2,(H,20,21) |
| InChIKey | JBXBFNSHELKFIJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.08 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|