C17H22O6 — CID 91220905
6-(3,5-diethoxyphenoxy)-2-methylidene-6-oxohexanoic acid (PubChem CID 91220905) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 6-(3,5-diethoxyphenoxy)-2-methylidene-6-oxohexanoic acid.
| Compound Name | 6-(3,5-diethoxyphenoxy)-2-methylidene-6-oxohexanoic acid |
|---|---|
| PubChem CID | 91220905 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 6-(3,5-diethoxyphenoxy)-2-methylidene-6-oxohexanoic acid |
| SMILES | C=C(CCCC(=O)Oc1cc(OCC)cc(OCC)c1)C(=O)O |
| InChI | InChI=1S/C17H22O6/c1-4-21-13-9-14(22-5-2)11-15(10-13)23-16(18)8-6-7-12(3)17(19)20/h9-11H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | JADXEVKFTMHYCE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|