About ethane;2-methylidenehexanoic acid
ethane;2-methylidenehexanoic acid (PubChem CID 162072915) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is ethane;2-methylidenehexanoic acid.
Molecular Properties
| Compound Name | ethane;2-methylidenehexanoic acid |
| PubChem CID | 162072915 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | ethane;2-methylidenehexanoic acid |
| SMILES | C=C(CCCC)C(=O)O.CC |
| InChI | InChI=1S/C7H12O2.C2H6/c1-3-4-5-6(2)7(8)9;1-2/h2-5H2,1H3,(H,8,9);1-2H3 |
| InChIKey | ZBIGKKOVYFWBQQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylidenehexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylidenehexanoic acid?
The IUPAC name of ethane;2-methylidenehexanoic acid (CID 162072915) is ethane;2-methylidenehexanoic acid.
What is the SMILES notation for ethane;2-methylidenehexanoic acid?
The canonical SMILES for ethane;2-methylidenehexanoic acid is C=C(CCCC)C(=O)O.CC.
What is the InChIKey of ethane;2-methylidenehexanoic acid?
The InChIKey is ZBIGKKOVYFWBQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C2H6/c1-3-4-5-6(2)7(8)9;1-2/h2-5H2,1H3,(H,8,9);1-2H3.
What are the key properties of ethane;2-methylidenehexanoic acid?
ethane;2-methylidenehexanoic acid has a molecular weight of 158.24 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylidenehexanoic acid is sourced from PubChem (CID 162072915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).