About 2-methylidenepentanoic acid;hydrate
2-methylidenepentanoic acid;hydrate (PubChem CID 88770361) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-methylidenepentanoic acid;hydrate.
Molecular Properties
| Compound Name | 2-methylidenepentanoic acid;hydrate |
| PubChem CID | 88770361 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 2-methylidenepentanoic acid;hydrate |
| SMILES | C=C(CCC)C(=O)O.O |
| InChI | InChI=1S/C6H10O2.H2O/c1-3-4-5(2)6(7)8;/h2-4H2,1H3,(H,7,8);1H2 |
| InChIKey | LXSVHINRVXJLQF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenepentanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenepentanoic acid;hydrate?
The IUPAC name of 2-methylidenepentanoic acid;hydrate (CID 88770361) is 2-methylidenepentanoic acid;hydrate.
What is the SMILES notation for 2-methylidenepentanoic acid;hydrate?
The canonical SMILES for 2-methylidenepentanoic acid;hydrate is C=C(CCC)C(=O)O.O.
What is the InChIKey of 2-methylidenepentanoic acid;hydrate?
The InChIKey is LXSVHINRVXJLQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.H2O/c1-3-4-5(2)6(7)8;/h2-4H2,1H3,(H,7,8);1H2.
What are the key properties of 2-methylidenepentanoic acid;hydrate?
2-methylidenepentanoic acid;hydrate has a molecular weight of 132.16 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenepentanoic acid;hydrate is sourced from PubChem (CID 88770361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).