C15H23NO4 — CID 87469422
2-methylidenebutanoic acid;2-methylidenehexanoic acid;prop-2-enenitrile (PubChem CID 87469422) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-methylidenebutanoic acid;2-methylidenehexanoic acid;prop-2-enenitrile.
| Compound Name | 2-methylidenebutanoic acid;2-methylidenehexanoic acid;prop-2-enenitrile |
|---|---|
| PubChem CID | 87469422 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-methylidenebutanoic acid;2-methylidenehexanoic acid;prop-2-enenitrile |
| SMILES | C=C(CC)C(=O)O.C=C(CCCC)C(=O)O.C=CC#N |
| InChI | InChI=1S/C7H12O2.C5H8O2.C3H3N/c1-3-4-5-6(2)7(8)9;1-3-4(2)5(6)7;1-2-3-4/h2-5H2,1H3,(H,8,9);2-3H2,1H3,(H,6,7);2H,1H2 |
| InChIKey | OFDLVHPPWJHUPP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|