About 2-methylidenehexanenitrile;prop-2-enenitrile
2-methylidenehexanenitrile;prop-2-enenitrile (PubChem CID 159125539) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-methylidenehexanenitrile;prop-2-enenitrile.
Molecular Properties
| Compound Name | 2-methylidenehexanenitrile;prop-2-enenitrile |
| PubChem CID | 159125539 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-methylidenehexanenitrile;prop-2-enenitrile |
| SMILES | C=C(C#N)CCCC.C=CC#N |
| InChI | InChI=1S/C7H11N.C3H3N/c1-3-4-5-7(2)6-8;1-2-3-4/h2-5H2,1H3;2H,1H2 |
| InChIKey | KGFMNABBDVVXHR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenehexanenitrile;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenehexanenitrile;prop-2-enenitrile?
The IUPAC name of 2-methylidenehexanenitrile;prop-2-enenitrile (CID 159125539) is 2-methylidenehexanenitrile;prop-2-enenitrile.
What is the SMILES notation for 2-methylidenehexanenitrile;prop-2-enenitrile?
The canonical SMILES for 2-methylidenehexanenitrile;prop-2-enenitrile is C=C(C#N)CCCC.C=CC#N.
What is the InChIKey of 2-methylidenehexanenitrile;prop-2-enenitrile?
The InChIKey is KGFMNABBDVVXHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C3H3N/c1-3-4-5-7(2)6-8;1-2-3-4/h2-5H2,1H3;2H,1H2.
What are the key properties of 2-methylidenehexanenitrile;prop-2-enenitrile?
2-methylidenehexanenitrile;prop-2-enenitrile has a molecular weight of 162.24 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenehexanenitrile;prop-2-enenitrile is sourced from PubChem (CID 159125539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).