C15H23NO2 — CID 88505105
2-methylbuta-1,3-diene;2-methylidenehexanoic acid;prop-2-enenitrile (PubChem CID 88505105) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;2-methylidenehexanoic acid;prop-2-enenitrile.
| Compound Name | 2-methylbuta-1,3-diene;2-methylidenehexanoic acid;prop-2-enenitrile |
|---|---|
| PubChem CID | 88505105 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-methylbuta-1,3-diene;2-methylidenehexanoic acid;prop-2-enenitrile |
| SMILES | C=C(CCCC)C(=O)O.C=CC#N.C=CC(=C)C |
| InChI | InChI=1S/C7H12O2.C5H8.C3H3N/c1-3-4-5-6(2)7(8)9;1-4-5(2)3;1-2-3-4/h2-5H2,1H3,(H,8,9);4H,1-2H2,3H3;2H,1H2 |
| InChIKey | INWYRXYPSDFCRK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|