About acetic acid;butanoic acid;prop-2-enenitrile
acetic acid;butanoic acid;prop-2-enenitrile (PubChem CID 87328549) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is acetic acid;butanoic acid;prop-2-enenitrile.
Molecular Properties
| Compound Name | acetic acid;butanoic acid;prop-2-enenitrile |
| PubChem CID | 87328549 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | acetic acid;butanoic acid;prop-2-enenitrile |
| SMILES | C=CC#N.CC(=O)O.CCCC(=O)O |
| InChI | InChI=1S/C4H8O2.C3H3N.C2H4O2/c1-2-3-4(5)6;1-2-3-4;1-2(3)4/h2-3H2,1H3,(H,5,6);2H,1H2;1H3,(H,3,4) |
| InChIKey | SOPXNCHJMWOBRT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;butanoic acid;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;butanoic acid;prop-2-enenitrile?
The IUPAC name of acetic acid;butanoic acid;prop-2-enenitrile (CID 87328549) is acetic acid;butanoic acid;prop-2-enenitrile.
What is the SMILES notation for acetic acid;butanoic acid;prop-2-enenitrile?
The canonical SMILES for acetic acid;butanoic acid;prop-2-enenitrile is C=CC#N.CC(=O)O.CCCC(=O)O.
What is the InChIKey of acetic acid;butanoic acid;prop-2-enenitrile?
The InChIKey is SOPXNCHJMWOBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C3H3N.C2H4O2/c1-2-3-4(5)6;1-2-3-4;1-2(3)4/h2-3H2,1H3,(H,5,6);2H,1H2;1H3,(H,3,4).
What are the key properties of acetic acid;butanoic acid;prop-2-enenitrile?
acetic acid;butanoic acid;prop-2-enenitrile has a molecular weight of 201.22 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;butanoic acid;prop-2-enenitrile is sourced from PubChem (CID 87328549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).