C15H10Br2O3 — CID 4766699
(2,4-dibromo-6-formylphenyl) 3-methylbenzoate (PubChem CID 4766699) has the molecular formula C15H10Br2O3 and a molecular weight of 398.05 g/mol. Its IUPAC name is (2,4-dibromo-6-formylphenyl) 3-methylbenzoate.
| Compound Name | (2,4-dibromo-6-formylphenyl) 3-methylbenzoate |
|---|---|
| PubChem CID | 4766699 |
| Molecular Formula | C15H10Br2O3 |
| Molecular Weight | 398.05 g/mol |
| Exact Mass | 395.90 |
| IUPAC Name | (2,4-dibromo-6-formylphenyl) 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2c(Br)cc(Br)cc2C=O)c1 |
| InChI | InChI=1S/C15H10Br2O3/c1-9-3-2-4-10(5-9)15(19)20-14-11(8-18)6-12(16)7-13(14)17/h2-8H,1H3 |
| InChIKey | OKFRLAYBJAZCCY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.05 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|