C29H18Br2ClN3O3 — CID 126152004
[2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate (PubChem CID 126152004) has the molecular formula C29H18Br2ClN3O3 and a molecular weight of 651.74 g/mol. Its IUPAC name is [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate.
| Compound Name | [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126152004 |
| Molecular Formula | C29H18Br2ClN3O3 |
| Molecular Weight | 651.74 g/mol |
| Exact Mass | 648.94 |
| IUPAC Name | [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2c(Br)cc(Br)cc2C=Nn2c(-c3ccc(Cl)cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C29H18Br2ClN3O3/c1-17-5-4-6-19(13-17)29(37)38-26-20(14-21(30)15-24(26)31)16-33-35-27(18-9-11-22(32)12-10-18)34-25-8-3-2-7-23(25)28(35)36/h2-16H,1H3 |
| InChIKey | JBVXHDPEFITVIB-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.74 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|