C26H14Br2ClN3O4 — CID 126132637
[2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate (PubChem CID 126132637) has the molecular formula C26H14Br2ClN3O4 and a molecular weight of 627.68 g/mol. Its IUPAC name is [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate.
| Compound Name | [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126132637 |
| Molecular Formula | C26H14Br2ClN3O4 |
| Molecular Weight | 627.68 g/mol |
| Exact Mass | 624.90 |
| IUPAC Name | [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1C=Nn1c(-c2ccc(Cl)cc2)nc2ccccc2c1=O)c1ccco1 |
| InChI | InChI=1S/C26H14Br2ClN3O4/c27-17-12-16(23(20(28)13-17)36-26(34)22-6-3-11-35-22)14-30-32-24(15-7-9-18(29)10-8-15)31-21-5-2-1-4-19(21)25(32)33/h1-14H |
| InChIKey | OMRRFEFCZCUHLQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 86.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|