C30H16Br2Cl3N3O3 — CID 126152949
[2,4-dibromo-6-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126152949) has the molecular formula C30H16Br2Cl3N3O3 and a molecular weight of 732.64 g/mol. Its IUPAC name is [2,4-dibromo-6-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2,4-dibromo-6-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126152949 |
| Molecular Formula | C30H16Br2Cl3N3O3 |
| Molecular Weight | 732.64 g/mol |
| Exact Mass | 728.86 |
| IUPAC Name | [2,4-dibromo-6-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Oc1c(Br)cc(Br)cc1C=Nn1c(-c2ccc(Cl)cc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H16Br2Cl3N3O3/c31-19-13-18(28(24(32)14-19)41-27(39)12-7-17-5-8-20(33)9-6-17)16-36-38-29(22-11-10-21(34)15-25(22)35)37-26-4-2-1-3-23(26)30(38)40/h1-16H/b12-7+,36-16? |
| InChIKey | VIJQOUYAQZJSKX-NGUVFIAZSA-N |
| XLogP | 9.05 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.64 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|