C31H23Br2N3O6 — CID 126150158
[2,4-dibromo-6-[[4-oxo-2-(3,4,5-trimethoxyphenyl)quinazolin-3-yl]iminomethyl]phenyl] benzoate (PubChem CID 126150158) has the molecular formula C31H23Br2N3O6 and a molecular weight of 693.35 g/mol. Its IUPAC name is [2,4-dibromo-6-[[4-oxo-2-(3,4,5-trimethoxyphenyl)quinazolin-3-yl]iminomethyl]phenyl] benzoate.
| Compound Name | [2,4-dibromo-6-[[4-oxo-2-(3,4,5-trimethoxyphenyl)quinazolin-3-yl]iminomethyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126150158 |
| Molecular Formula | C31H23Br2N3O6 |
| Molecular Weight | 693.35 g/mol |
| Exact Mass | 691.00 |
| IUPAC Name | [2,4-dibromo-6-[[4-oxo-2-(3,4,5-trimethoxyphenyl)quinazolin-3-yl]iminomethyl]phenyl] benzoate |
| SMILES | COc1cc(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)cc(Br)c2OC(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C31H23Br2N3O6/c1-39-25-14-19(15-26(40-2)28(25)41-3)29-35-24-12-8-7-11-22(24)30(37)36(29)34-17-20-13-21(32)16-23(33)27(20)42-31(38)18-9-5-4-6-10-18/h4-17H,1-3H3 |
| InChIKey | NXTHVXKYNJXWRU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.35 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|