C27H17Br2N3O4 — CID 126139041
[2,4-dibromo-6-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-methylbenzoate (PubChem CID 126139041) has the molecular formula C27H17Br2N3O4 and a molecular weight of 607.26 g/mol. Its IUPAC name is [2,4-dibromo-6-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-methylbenzoate.
| Compound Name | [2,4-dibromo-6-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126139041 |
| Molecular Formula | C27H17Br2N3O4 |
| Molecular Weight | 607.26 g/mol |
| Exact Mass | 604.96 |
| IUPAC Name | [2,4-dibromo-6-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2c(Br)cc(Br)cc2C=Nn2c(-c3ccco3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H17Br2N3O4/c1-16-8-10-17(11-9-16)27(34)36-24-18(13-19(28)14-21(24)29)15-30-32-25(23-7-4-12-35-23)31-22-6-3-2-5-20(22)26(32)33/h2-15H,1H3 |
| InChIKey | JWCFIJIIWNRVFR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 86.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.26 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|