C29H18Br3N3O3 — CID 126141252
[2,4-dibromo-6-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-bromobenzoate (PubChem CID 126141252) has the molecular formula C29H18Br3N3O3 and a molecular weight of 696.19 g/mol. Its IUPAC name is [2,4-dibromo-6-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-bromobenzoate.
| Compound Name | [2,4-dibromo-6-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 126141252 |
| Molecular Formula | C29H18Br3N3O3 |
| Molecular Weight | 696.19 g/mol |
| Exact Mass | 692.89 |
| IUPAC Name | [2,4-dibromo-6-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-bromobenzoate |
| SMILES | Cc1ccc(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)cc(Br)c2OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C29H18Br3N3O3/c1-17-6-8-18(9-7-17)27-34-25-5-3-2-4-23(25)28(36)35(27)33-16-20-14-22(31)15-24(32)26(20)38-29(37)19-10-12-21(30)13-11-19/h2-16H,1H3 |
| InChIKey | PCYRFTZXONLNQB-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.19 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|