C30H17Br2N5O7 — CID 126153677
[2,4-dibromo-6-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126153677) has the molecular formula C30H17Br2N5O7 and a molecular weight of 719.30 g/mol. Its IUPAC name is [2,4-dibromo-6-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2,4-dibromo-6-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126153677 |
| Molecular Formula | C30H17Br2N5O7 |
| Molecular Weight | 719.30 g/mol |
| Exact Mass | 716.95 |
| IUPAC Name | [2,4-dibromo-6-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)Oc1c(Br)cc(Br)cc1C=Nn1c(-c2ccc([N+](=O)[O-])cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H17Br2N5O7/c31-21-15-20(28(25(32)16-21)44-27(38)14-7-18-5-10-22(11-6-18)36(40)41)17-33-35-29(19-8-12-23(13-9-19)37(42)43)34-26-4-2-1-3-24(26)30(35)39/h1-17H/b14-7+,33-17? |
| InChIKey | WGXSJIYXWWNDPJ-LKOQOYEOSA-N |
| XLogP | 6.91 |
| TPSA | 159.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.30 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|