C30H17Br2ClN4O5 — CID 126147827
[2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126147827) has the molecular formula C30H17Br2ClN4O5 and a molecular weight of 708.75 g/mol. Its IUPAC name is [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126147827 |
| Molecular Formula | C30H17Br2ClN4O5 |
| Molecular Weight | 708.75 g/mol |
| Exact Mass | 705.93 |
| IUPAC Name | [2,4-dibromo-6-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Oc1c(Br)cc(Br)cc1C=Nn1c(-c2ccc(Cl)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H17Br2ClN4O5/c31-21-15-20(28(25(32)16-21)42-27(38)13-8-18-4-3-5-23(14-18)37(40)41)17-34-36-29(19-9-11-22(33)12-10-19)35-26-7-2-1-6-24(26)30(36)39/h1-17H/b13-8+,34-17? |
| InChIKey | VIAZSENBNADSCO-UEFMSLCGSA-N |
| XLogP | 7.65 |
| TPSA | 116.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|