C31H21BrN4O6 — CID 126135591
[4-bromo-2-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126135591) has the molecular formula C31H21BrN4O6 and a molecular weight of 625.44 g/mol. Its IUPAC name is [4-bromo-2-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [4-bromo-2-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126135591 |
| Molecular Formula | C31H21BrN4O6 |
| Molecular Weight | 625.44 g/mol |
| Exact Mass | 624.06 |
| IUPAC Name | [4-bromo-2-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | COc1ccc(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)ccc2OC(=O)/C=C/c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C31H21BrN4O6/c1-41-25-13-10-21(11-14-25)30-34-27-8-3-2-7-26(27)31(38)35(30)33-19-22-18-23(32)12-15-28(22)42-29(37)16-9-20-5-4-6-24(17-20)36(39)40/h2-19H,1H3/b16-9+,33-19? |
| InChIKey | KSZYWOXMJPFJCP-LFABJMPPSA-N |
| XLogP | 6.24 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|