C29H20N4O7 — CID 126130735
[4-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126130735) has the molecular formula C29H20N4O7 and a molecular weight of 536.50 g/mol. Its IUPAC name is [4-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [4-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126130735 |
| Molecular Formula | C29H20N4O7 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | [4-[[2-(furan-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | COc1cc(C=Nn2c(-c3ccco3)nc3ccccc3c2=O)ccc1OC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H20N4O7/c1-38-26-17-20(11-13-24(26)40-27(34)14-12-19-6-4-7-21(16-19)33(36)37)18-30-32-28(25-10-5-15-39-25)31-23-9-3-2-8-22(23)29(32)35/h2-18H,1H3/b14-12+,30-18? |
| InChIKey | AARPLOJUNKGAFS-KPSXMYAHSA-N |
| XLogP | 5.07 |
| TPSA | 139.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|