C28H25N3O4 — CID 3761081
[2-methoxy-4-[(4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 3761081) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is [2-methoxy-4-[(4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [2-methoxy-4-[(4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3761081 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [2-methoxy-4-[(4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | COc1cc(C=Nn2c(C(C)C)nc3ccccc3c2=O)ccc1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C28H25N3O4/c1-19(2)27-30-23-12-8-7-11-22(23)28(33)31(27)29-18-21-13-15-24(25(17-21)34-3)35-26(32)16-14-20-9-5-4-6-10-20/h4-19H,1-3H3 |
| InChIKey | QADHZXURGLHNFR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|