C25H23N3O5 — CID 6859761
2-(3,4-dimethoxyphenyl)-3-[(E)-(3,4-dimethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 6859761) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-[(E)-(3,4-dimethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-[(E)-(3,4-dimethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 6859761 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-[(E)-(3,4-dimethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | COc1ccc(/C=N/n2c(-c3ccc(OC)c(OC)c3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C25H23N3O5/c1-30-20-11-9-16(13-22(20)32-3)15-26-28-24(17-10-12-21(31-2)23(14-17)33-4)27-19-8-6-5-7-18(19)25(28)29/h5-15H,1-4H3/b26-15+ |
| InChIKey | HSKFFLRWLSKVGL-CVKSISIWSA-N |
| XLogP | 3.98 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|