C25H22ClN3O3 — CID 73316585
6-chloro-2-(3,4-dimethoxyphenyl)-3-[(3,4-dimethylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 73316585) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is 6-chloro-2-(3,4-dimethoxyphenyl)-3-[(3,4-dimethylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-chloro-2-(3,4-dimethoxyphenyl)-3-[(3,4-dimethylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 73316585 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 6-chloro-2-(3,4-dimethoxyphenyl)-3-[(3,4-dimethylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3ccc(Cl)cc3c(=O)n2N=Cc2ccc(C)c(C)c2)cc1OC |
| InChI | InChI=1S/C25H22ClN3O3/c1-15-5-6-17(11-16(15)2)14-27-29-24(18-7-10-22(31-3)23(12-18)32-4)28-21-9-8-19(26)13-20(21)25(29)30/h5-14H,1-4H3 |
| InChIKey | ZVVLVKBYJKASOL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|