C30H22ClN3O4 — CID 126143023
[4-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenyl] benzoate (PubChem CID 126143023) has the molecular formula C30H22ClN3O4 and a molecular weight of 523.98 g/mol. Its IUPAC name is [4-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenyl] benzoate.
| Compound Name | [4-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 126143023 |
| Molecular Formula | C30H22ClN3O4 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [4-[[2-(4-chlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(C=Nn2c(-c3ccc(Cl)cc3)nc3ccccc3c2=O)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22ClN3O4/c1-2-37-27-18-20(12-17-26(27)38-30(36)22-8-4-3-5-9-22)19-32-34-28(21-13-15-23(31)16-14-21)33-25-11-7-6-10-24(25)29(34)35/h3-19H,2H2,1H3 |
| InChIKey | UXTVDLSDVCZDFT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|