C34H31N3O7 — CID 126151713
[2-ethoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126151713) has the molecular formula C34H31N3O7 and a molecular weight of 593.64 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-ethoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126151713 |
| Molecular Formula | C34H31N3O7 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOc1cc(C=Nn2c(-c3ccc(C)cc3)nc3ccccc3c2=O)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C34H31N3O7/c1-6-43-28-17-22(13-16-27(28)44-34(39)24-18-29(40-3)31(42-5)30(19-24)41-4)20-35-37-32(23-14-11-21(2)12-15-23)36-26-10-8-7-9-25(26)33(37)38/h7-20H,6H2,1-5H3 |
| InChIKey | QCHOOTYJBMNEHR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 110.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|