C31H24ClN3O5 — CID 126152218
[2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-chlorobenzoate (PubChem CID 126152218) has the molecular formula C31H24ClN3O5 and a molecular weight of 554.00 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126152218 |
| Molecular Formula | C31H24ClN3O5 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 4-chlorobenzoate |
| SMILES | CCOc1cc(C=Nn2c(-c3ccc(OC)cc3)nc3ccccc3c2=O)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H24ClN3O5/c1-3-39-28-18-20(8-17-27(28)40-31(37)22-9-13-23(32)14-10-22)19-33-35-29(21-11-15-24(38-2)16-12-21)34-26-7-5-4-6-25(26)30(35)36/h4-19H,3H2,1-2H3 |
| InChIKey | SOEZSSYPMFRWPP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|