C32H27N3O5 — CID 126143819
[2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate (PubChem CID 126143819) has the molecular formula C32H27N3O5 and a molecular weight of 533.58 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate.
| Compound Name | [2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126143819 |
| Molecular Formula | C32H27N3O5 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 3-methylbenzoate |
| SMILES | CCOc1cc(C=Nn2c(-c3ccc(OC)cc3)nc3ccccc3c2=O)ccc1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C32H27N3O5/c1-4-39-29-19-22(12-17-28(29)40-32(37)24-9-7-8-21(2)18-24)20-33-35-30(23-13-15-25(38-3)16-14-23)34-27-11-6-5-10-26(27)31(35)36/h5-20H,4H2,1-3H3 |
| InChIKey | WXTHEQOMQASKEQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|