C31H22N4O8 — CID 126152015
[2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126152015) has the molecular formula C31H22N4O8 and a molecular weight of 578.54 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126152015 |
| Molecular Formula | C31H22N4O8 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-nitrophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOc1cc(C=Nn2c(-c3ccc([N+](=O)[O-])cc3)nc3ccccc3c2=O)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H22N4O8/c1-2-40-27-15-19(7-13-26(27)43-31(37)21-10-14-25-28(16-21)42-18-41-25)17-32-34-29(20-8-11-22(12-9-20)35(38)39)33-24-6-4-3-5-23(24)30(34)36/h3-17H,2,18H2,1H3 |
| InChIKey | ROXCFXLQRCTGQW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 144.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|