C30H20BrN3O5 — CID 126154072
[4-bromo-2-[[2-(3-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126154072) has the molecular formula C30H20BrN3O5 and a molecular weight of 582.41 g/mol. Its IUPAC name is [4-bromo-2-[[2-(3-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-bromo-2-[[2-(3-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126154072 |
| Molecular Formula | C30H20BrN3O5 |
| Molecular Weight | 582.41 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | [4-bromo-2-[[2-(3-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1cccc(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)ccc2OC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C30H20BrN3O5/c1-18-5-4-6-19(13-18)28-33-24-8-3-2-7-23(24)29(35)34(28)32-16-21-14-22(31)10-12-25(21)39-30(36)20-9-11-26-27(15-20)38-17-37-26/h2-16H,17H2,1H3 |
| InChIKey | WEDJTIGBPHJSHS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|