C29H16BrCl2N3O5 — CID 126138681
[4-bromo-2-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126138681) has the molecular formula C29H16BrCl2N3O5 and a molecular weight of 637.27 g/mol. Its IUPAC name is [4-bromo-2-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-bromo-2-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126138681 |
| Molecular Formula | C29H16BrCl2N3O5 |
| Molecular Weight | 637.27 g/mol |
| Exact Mass | 634.97 |
| IUPAC Name | [4-bromo-2-[[2-(2,4-dichlorophenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1C=Nn1c(-c2ccc(Cl)cc2Cl)nc2ccccc2c1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H16BrCl2N3O5/c30-18-6-10-24(40-29(37)16-5-9-25-26(12-16)39-15-38-25)17(11-18)14-33-35-27(20-8-7-19(31)13-22(20)32)34-23-4-2-1-3-21(23)28(35)36/h1-14H,15H2 |
| InChIKey | OIHCHEFZWXQTTO-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.27 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|